C29H40F2N2 — CID 166656535
(3Z,5E,7E)-5-ethylidene-2,2-difluoro-9-methyl-6-methylidene-8-[(1E,7Z)-4-methyl-3-[(Z)-4-(methylamino)but-1-enyl]-6-methylidenecycloocta-1,7-dien-1-yl]deca-3,7,9-trien-3-amine (PubChem CID 166656535) has the molecular formula C29H40F2N2 and a molecular weight of 454.65 g/mol. Its IUPAC name is (3Z,5E,7E)-5-ethylidene-2,2-difluoro-9-methyl-6-methylidene-8-[(1E,7Z)-4-methyl-3-[(Z)-4-(methylamino)but-1-enyl]-6-methylidenecycloocta-1,7-dien-1-yl]deca-3,7,9-trien-3-amine.
| Compound Name | (3Z,5E,7E)-5-ethylidene-2,2-difluoro-9-methyl-6-methylidene-8-[(1E,7Z)-4-methyl-3-[(Z)-4-(methylamino)but-1-enyl]-6-methylidenecycloocta-1,7-dien-1-yl]deca-3,7,9-trien-3-amine |
|---|---|
| PubChem CID | 166656535 |
| Molecular Formula | C29H40F2N2 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.32 |
| IUPAC Name | (3Z,5E,7E)-5-ethylidene-2,2-difluoro-9-methyl-6-methylidene-8-[(1E,7Z)-4-methyl-3-[(Z)-4-(methylamino)but-1-enyl]-6-methylidenecycloocta-1,7-dien-1-yl]deca-3,7,9-trien-3-amine |
| SMILES | C=C1/C=C\C(\C(=C\C(=C)C(/C=C(\N)C(C)(F)F)=C/C)C(=C)C)=C/C(/C=C\CCNC)C(C)C1 |
| InChI | InChI=1S/C29H40F2N2/c1-9-24(19-28(32)29(7,30)31)23(6)17-27(20(2)3)26-14-13-21(4)16-22(5)25(18-26)12-10-11-15-33-8/h9-10,12-14,17-19,22,25,33H,2,4,6,11,15-16,32H2,1,3,5,7-8H3/b12-10-,14-13-,24-9+,26-18+,27-17+,28-19- |
| InChIKey | ORNIJEJEHSRNLK-MALBUOFVSA-N |
| XLogP | 7.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|