C19H23N3O2 — CID 166656655
9-(5-amino-2-methylphenyl)-6-methyl-2,4,4a,5-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridin-6-ol (PubChem CID 166656655) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 9-(5-amino-2-methylphenyl)-6-methyl-2,4,4a,5-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridin-6-ol.
| Compound Name | 9-(5-amino-2-methylphenyl)-6-methyl-2,4,4a,5-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridin-6-ol |
|---|---|
| PubChem CID | 166656655 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 9-(5-amino-2-methylphenyl)-6-methyl-2,4,4a,5-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridin-6-ol |
| SMILES | Cc1ccc(N)cc1-c1cnc2c(c1)N1CCOCC1CC2(C)O |
| InChI | InChI=1S/C19H23N3O2/c1-12-3-4-14(20)8-16(12)13-7-17-18(21-10-13)19(2,23)9-15-11-24-6-5-22(15)17/h3-4,7-8,10,15,23H,5-6,9,11,20H2,1-2H3 |
| InChIKey | ZNSVKOGZLHSXQT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 71.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|