About 3-(3,3-difluorocyclopentyl)-4-ethyl-5-(trifluoromethyl)-1,2-thiazole
3-(3,3-difluorocyclopentyl)-4-ethyl-5-(trifluoromethyl)-1,2-thiazole (PubChem CID 166657101) has the molecular formula C11H12F5NS
and a molecular weight of 285.28 g/mol. Its IUPAC name is 3-(3,3-difluorocyclopentyl)-4-ethyl-5-(trifluoromethyl)-1,2-thiazole.
Molecular Properties
| Compound Name | 3-(3,3-difluorocyclopentyl)-4-ethyl-5-(trifluoromethyl)-1,2-thiazole |
| PubChem CID | 166657101 |
| Molecular Formula | C11H12F5NS |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 3-(3,3-difluorocyclopentyl)-4-ethyl-5-(trifluoromethyl)-1,2-thiazole |
| SMILES | CCc1c(C2CCC(F)(F)C2)nsc1C(F)(F)F |
| InChI | InChI=1S/C11H12F5NS/c1-2-7-8(6-3-4-10(12,13)5-6)17-18-9(7)11(14,15)16/h6H,2-5H2,1H3 |
| InChIKey | WCBWIJVZFOXQSX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,3-difluorocyclopentyl)-4-ethyl-5-(trifluoromethyl)-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-difluorocyclopentyl)-4-ethyl-5-(trifluoromethyl)-1,2-thiazole?
The IUPAC name of 3-(3,3-difluorocyclopentyl)-4-ethyl-5-(trifluoromethyl)-1,2-thiazole (CID 166657101) is 3-(3,3-difluorocyclopentyl)-4-ethyl-5-(trifluoromethyl)-1,2-thiazole.
What is the SMILES notation for 3-(3,3-difluorocyclopentyl)-4-ethyl-5-(trifluoromethyl)-1,2-thiazole?
The canonical SMILES for 3-(3,3-difluorocyclopentyl)-4-ethyl-5-(trifluoromethyl)-1,2-thiazole is CCc1c(C2CCC(F)(F)C2)nsc1C(F)(F)F.
What is the InChIKey of 3-(3,3-difluorocyclopentyl)-4-ethyl-5-(trifluoromethyl)-1,2-thiazole?
The InChIKey is WCBWIJVZFOXQSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F5NS/c1-2-7-8(6-3-4-10(12,13)5-6)17-18-9(7)11(14,15)16/h6H,2-5H2,1H3.
What are the key properties of 3-(3,3-difluorocyclopentyl)-4-ethyl-5-(trifluoromethyl)-1,2-thiazole?
3-(3,3-difluorocyclopentyl)-4-ethyl-5-(trifluoromethyl)-1,2-thiazole has a molecular weight of 285.28 g/mol, XLogP of 4.63, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-difluorocyclopentyl)-4-ethyl-5-(trifluoromethyl)-1,2-thiazole is sourced from PubChem (CID 166657101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).