C29H34ClN5O — CID 166657184
(Z)-2-(3-chloro-2H-pyridin-1-yl)-3-(methylideneamino)-N-[[4-[4-(4-methylphenyl)piperazin-1-yl]phenyl]methyl]pent-2-enamide (PubChem CID 166657184) has the molecular formula C29H34ClN5O and a molecular weight of 504.08 g/mol. Its IUPAC name is (Z)-2-(3-chloro-2H-pyridin-1-yl)-3-(methylideneamino)-N-[[4-[4-(4-methylphenyl)piperazin-1-yl]phenyl]methyl]pent-2-enamide.
| Compound Name | (Z)-2-(3-chloro-2H-pyridin-1-yl)-3-(methylideneamino)-N-[[4-[4-(4-methylphenyl)piperazin-1-yl]phenyl]methyl]pent-2-enamide |
|---|---|
| PubChem CID | 166657184 |
| Molecular Formula | C29H34ClN5O |
| Molecular Weight | 504.08 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | (Z)-2-(3-chloro-2H-pyridin-1-yl)-3-(methylideneamino)-N-[[4-[4-(4-methylphenyl)piperazin-1-yl]phenyl]methyl]pent-2-enamide |
| SMILES | C=N/C(CC)=C(/C(=O)NCc1ccc(N2CCN(c3ccc(C)cc3)CC2)cc1)N1C=CC=C(Cl)C1 |
| InChI | InChI=1S/C29H34ClN5O/c1-4-27(31-3)28(35-15-5-6-24(30)21-35)29(36)32-20-23-9-13-26(14-10-23)34-18-16-33(17-19-34)25-11-7-22(2)8-12-25/h5-15H,3-4,16-21H2,1-2H3,(H,32,36)/b28-27- |
| InChIKey | OUMUGGAAUVYSFC-DQSJHHFOSA-N |
| XLogP | 5.21 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.08 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|