C24H36N2 — CID 166657482
8,15-dimethyl-14-(3-methylbutyl)-3-propan-2-yl-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-4,6,9,13(16)-tetraene (PubChem CID 166657482) has the molecular formula C24H36N2 and a molecular weight of 352.57 g/mol. Its IUPAC name is 8,15-dimethyl-14-(3-methylbutyl)-3-propan-2-yl-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-4,6,9,13(16)-tetraene.
| Compound Name | 8,15-dimethyl-14-(3-methylbutyl)-3-propan-2-yl-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-4,6,9,13(16)-tetraene |
|---|---|
| PubChem CID | 166657482 |
| Molecular Formula | C24H36N2 |
| Molecular Weight | 352.57 g/mol |
| Exact Mass | 352.29 |
| IUPAC Name | 8,15-dimethyl-14-(3-methylbutyl)-3-propan-2-yl-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-4,6,9,13(16)-tetraene |
| SMILES | CC(C)CCN1C2=C3C(=CCC2)C(C)C2=CC=CC(C(C)C)C2N3C1C |
| InChI | InChI=1S/C24H36N2/c1-15(2)13-14-25-18(6)26-23-19(16(3)4)9-7-10-20(23)17(5)21-11-8-12-22(25)24(21)26/h7,9-11,15-19,23H,8,12-14H2,1-6H3 |
| InChIKey | IUVFNERDQJGJTJ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.57 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |