C22H22ClFN4O5S — CID 166657574
(4aS,7R,8aR)-4a-[5-[(4-chloro-3-pyridinyl)oxy]-2-fluorophenyl]-7-(1-methoxyethenyl)-2-methyl-8-methylidene-1,1-dioxo-5,8a-dihydropyrano[3,4-e][1,2,4]thiadiazin-3-amine (PubChem CID 166657574) has the molecular formula C22H22ClFN4O5S and a molecular weight of 508.96 g/mol. Its IUPAC name is (4aS,7R,8aR)-4a-[5-[(4-chloro-3-pyridinyl)oxy]-2-fluorophenyl]-7-(1-methoxyethenyl)-2-methyl-8-methylidene-1,1-dioxo-5,8a-dihydropyrano[3,4-e][1,2,4]thiadiazin-3-amine.
| Compound Name | (4aS,7R,8aR)-4a-[5-[(4-chloro-3-pyridinyl)oxy]-2-fluorophenyl]-7-(1-methoxyethenyl)-2-methyl-8-methylidene-1,1-dioxo-5,8a-dihydropyrano[3,4-e][1,2,4]thiadiazin-3-amine |
|---|---|
| PubChem CID | 166657574 |
| Molecular Formula | C22H22ClFN4O5S |
| Molecular Weight | 508.96 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | (4aS,7R,8aR)-4a-[5-[(4-chloro-3-pyridinyl)oxy]-2-fluorophenyl]-7-(1-methoxyethenyl)-2-methyl-8-methylidene-1,1-dioxo-5,8a-dihydropyrano[3,4-e][1,2,4]thiadiazin-3-amine |
| SMILES | C=C(OC)[C@@H]1OC[C@]2(c3cc(Oc4cnccc4Cl)ccc3F)N=C(N)N(C)S(=O)(=O)[C@@H]2C1=C |
| InChI | InChI=1S/C22H22ClFN4O5S/c1-12-19(13(2)31-4)32-11-22(20(12)34(29,30)28(3)21(25)27-22)15-9-14(5-6-17(15)24)33-18-10-26-8-7-16(18)23/h5-10,19-20H,1-2,11H2,3-4H3,(H2,25,27)/t19-,20-,22-/m1/s1 |
| InChIKey | CMIPCIZUBLGDKP-KCZVDYSFSA-N |
| XLogP | 2.94 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.96 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|