C19H20ClF2N5O2 — CID 166657618
(5R)-N-(5-chloro-2,4-difluorophenyl)-5,13-dimethyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 166657618) has the molecular formula C19H20ClF2N5O2 and a molecular weight of 423.85 g/mol. Its IUPAC name is (5R)-N-(5-chloro-2,4-difluorophenyl)-5,13-dimethyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | (5R)-N-(5-chloro-2,4-difluorophenyl)-5,13-dimethyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 166657618 |
| Molecular Formula | C19H20ClF2N5O2 |
| Molecular Weight | 423.85 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | (5R)-N-(5-chloro-2,4-difluorophenyl)-5,13-dimethyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)Nc1cc(Cl)c(F)cc1F)C(=O)N(C)CCC3 |
| InChI | InChI=1S/C19H20ClF2N5O2/c1-10-6-15-11(17-18(28)25(2)4-3-5-27(17)24-15)9-26(10)19(29)23-16-7-12(20)13(21)8-14(16)22/h7-8,10H,3-6,9H2,1-2H3,(H,23,29)/t10-/m1/s1 |
| InChIKey | WCQDXEMVQAMKDJ-SNVBAGLBSA-N |
| XLogP | 3.27 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.85 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|