About 3-[(Z)-but-1-enyl]-2,6-bis(ethenyl)-4-methyl-5-[(Z)-prop-1-enyl]-1,4-thiazine
3-[(Z)-but-1-enyl]-2,6-bis(ethenyl)-4-methyl-5-[(Z)-prop-1-enyl]-1,4-thiazine (PubChem CID 166657709) has the molecular formula C16H21NS
and a molecular weight of 259.42 g/mol. Its IUPAC name is 3-[(Z)-but-1-enyl]-2,6-bis(ethenyl)-4-methyl-5-[(Z)-prop-1-enyl]-1,4-thiazine.
Molecular Properties
| Compound Name | 3-[(Z)-but-1-enyl]-2,6-bis(ethenyl)-4-methyl-5-[(Z)-prop-1-enyl]-1,4-thiazine |
| PubChem CID | 166657709 |
| Molecular Formula | C16H21NS |
| Molecular Weight | 259.42 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 3-[(Z)-but-1-enyl]-2,6-bis(ethenyl)-4-methyl-5-[(Z)-prop-1-enyl]-1,4-thiazine |
| SMILES | C=CC1=C(/C=C\C)N(C)C(/C=C\CC)=C(C=C)S1 |
| InChI | InChI=1S/C16H21NS/c1-6-10-12-14-16(9-4)18-15(8-3)13(11-7-2)17(14)5/h7-12H,3-4,6H2,1-2,5H3/b11-7-,12-10- |
| InChIKey | ZPGRERKODYKTTM-QVOAAWBYSA-N |
| XLogP | 5.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 259.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(Z)-but-1-enyl]-2,6-bis(ethenyl)-4-methyl-5-[(Z)-prop-1-enyl]-1,4-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-but-1-enyl]-2,6-bis(ethenyl)-4-methyl-5-[(Z)-prop-1-enyl]-1,4-thiazine?
The IUPAC name of 3-[(Z)-but-1-enyl]-2,6-bis(ethenyl)-4-methyl-5-[(Z)-prop-1-enyl]-1,4-thiazine (CID 166657709) is 3-[(Z)-but-1-enyl]-2,6-bis(ethenyl)-4-methyl-5-[(Z)-prop-1-enyl]-1,4-thiazine.
What is the SMILES notation for 3-[(Z)-but-1-enyl]-2,6-bis(ethenyl)-4-methyl-5-[(Z)-prop-1-enyl]-1,4-thiazine?
The canonical SMILES for 3-[(Z)-but-1-enyl]-2,6-bis(ethenyl)-4-methyl-5-[(Z)-prop-1-enyl]-1,4-thiazine is C=CC1=C(/C=C\C)N(C)C(/C=C\CC)=C(C=C)S1.
What is the InChIKey of 3-[(Z)-but-1-enyl]-2,6-bis(ethenyl)-4-methyl-5-[(Z)-prop-1-enyl]-1,4-thiazine?
The InChIKey is ZPGRERKODYKTTM-QVOAAWBYSA-N. The full InChI is InChI=1S/C16H21NS/c1-6-10-12-14-16(9-4)18-15(8-3)13(11-7-2)17(14)5/h7-12H,3-4,6H2,1-2,5H3/b11-7-,12-10-.
What are the key properties of 3-[(Z)-but-1-enyl]-2,6-bis(ethenyl)-4-methyl-5-[(Z)-prop-1-enyl]-1,4-thiazine?
3-[(Z)-but-1-enyl]-2,6-bis(ethenyl)-4-methyl-5-[(Z)-prop-1-enyl]-1,4-thiazine has a molecular weight of 259.42 g/mol, XLogP of 5.00, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-but-1-enyl]-2,6-bis(ethenyl)-4-methyl-5-[(Z)-prop-1-enyl]-1,4-thiazine is sourced from PubChem (CID 166657709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).