C13H21N — CID 166657806
1,2-diethyl-3-methyl-2,3,6,7-tetrahydroindole (PubChem CID 166657806) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 1,2-diethyl-3-methyl-2,3,6,7-tetrahydroindole.
| Compound Name | 1,2-diethyl-3-methyl-2,3,6,7-tetrahydroindole |
|---|---|
| PubChem CID | 166657806 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 1,2-diethyl-3-methyl-2,3,6,7-tetrahydroindole |
| SMILES | CCC1C(C)C2=C(CCC=C2)N1CC |
| InChI | InChI=1S/C13H21N/c1-4-12-10(3)11-8-6-7-9-13(11)14(12)5-2/h6,8,10,12H,4-5,7,9H2,1-3H3 |
| InChIKey | QXWIUVYDTDOVKH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |