About 1,2-dimethyl-3-(4-methyl-2,6-diphenylphenyl)-2H-benzimidazole
1,2-dimethyl-3-(4-methyl-2,6-diphenylphenyl)-2H-benzimidazole (PubChem CID 166657827) has the molecular formula C28H26N2
and a molecular weight of 390.53 g/mol. Its IUPAC name is 1,2-dimethyl-3-(4-methyl-2,6-diphenylphenyl)-2H-benzimidazole.
Molecular Properties
| Compound Name | 1,2-dimethyl-3-(4-methyl-2,6-diphenylphenyl)-2H-benzimidazole |
| PubChem CID | 166657827 |
| Molecular Formula | C28H26N2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 1,2-dimethyl-3-(4-methyl-2,6-diphenylphenyl)-2H-benzimidazole |
| SMILES | Cc1cc(-c2ccccc2)c(N2c3ccccc3N(C)C2C)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C28H26N2/c1-20-18-24(22-12-6-4-7-13-22)28(25(19-20)23-14-8-5-9-15-23)30-21(2)29(3)26-16-10-11-17-27(26)30/h4-19,21H,1-3H3 |
| InChIKey | JPUGNXJAHSRYIU-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-dimethyl-3-(4-methyl-2,6-diphenylphenyl)-2H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-3-(4-methyl-2,6-diphenylphenyl)-2H-benzimidazole?
The IUPAC name of 1,2-dimethyl-3-(4-methyl-2,6-diphenylphenyl)-2H-benzimidazole (CID 166657827) is 1,2-dimethyl-3-(4-methyl-2,6-diphenylphenyl)-2H-benzimidazole.
What is the SMILES notation for 1,2-dimethyl-3-(4-methyl-2,6-diphenylphenyl)-2H-benzimidazole?
The canonical SMILES for 1,2-dimethyl-3-(4-methyl-2,6-diphenylphenyl)-2H-benzimidazole is Cc1cc(-c2ccccc2)c(N2c3ccccc3N(C)C2C)c(-c2ccccc2)c1.
What is the InChIKey of 1,2-dimethyl-3-(4-methyl-2,6-diphenylphenyl)-2H-benzimidazole?
The InChIKey is JPUGNXJAHSRYIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26N2/c1-20-18-24(22-12-6-4-7-13-22)28(25(19-20)23-14-8-5-9-15-23)30-21(2)29(3)26-16-10-11-17-27(26)30/h4-19,21H,1-3H3.
What are the key properties of 1,2-dimethyl-3-(4-methyl-2,6-diphenylphenyl)-2H-benzimidazole?
1,2-dimethyl-3-(4-methyl-2,6-diphenylphenyl)-2H-benzimidazole has a molecular weight of 390.53 g/mol, XLogP of 7.26, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-3-(4-methyl-2,6-diphenylphenyl)-2H-benzimidazole is sourced from PubChem (CID 166657827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).