C33H44N2 — CID 166657829
4-(2-cyclohexa-1,5-dien-1-yl-6-cyclohex-3-en-1-ylcyclohexa-1,3-dien-1-yl)-2-pentan-3-yl-1,2,3,3a,4a,8a-hexahydropyrrolo[1,2-a]benzimidazole (PubChem CID 166657829) has the molecular formula C33H44N2 and a molecular weight of 468.73 g/mol. Its IUPAC name is 4-(2-cyclohexa-1,5-dien-1-yl-6-cyclohex-3-en-1-ylcyclohexa-1,3-dien-1-yl)-2-pentan-3-yl-1,2,3,3a,4a,8a-hexahydropyrrolo[1,2-a]benzimidazole.
| Compound Name | 4-(2-cyclohexa-1,5-dien-1-yl-6-cyclohex-3-en-1-ylcyclohexa-1,3-dien-1-yl)-2-pentan-3-yl-1,2,3,3a,4a,8a-hexahydropyrrolo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 166657829 |
| Molecular Formula | C33H44N2 |
| Molecular Weight | 468.73 g/mol |
| Exact Mass | 468.35 |
| IUPAC Name | 4-(2-cyclohexa-1,5-dien-1-yl-6-cyclohex-3-en-1-ylcyclohexa-1,3-dien-1-yl)-2-pentan-3-yl-1,2,3,3a,4a,8a-hexahydropyrrolo[1,2-a]benzimidazole |
| SMILES | CCC(CC)C1CC2N(C1)C1C=CC=CC1N2C1=C(C2=CCCC=C2)C=CCC1C1CC=CCC1 |
| InChI | InChI=1S/C33H44N2/c1-3-24(4-2)27-22-32-34(23-27)30-20-11-12-21-31(30)35(32)33-28(25-14-7-5-8-15-25)18-13-19-29(33)26-16-9-6-10-17-26/h5,7,9,11-13,16-17,19-21,24-25,27-28,30-32H,3-4,6,8,10,14-15,18,22-23H2,1-2H3 |
| InChIKey | KAVAYCVIWQEXQS-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.73 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|