C21H19ClN6 — CID 166658139
8-chloro-6-[2-methyl-5-(methylamino)phenyl]-N-(6-methyl-3-pyridinyl)pyrido[3,4-d]pyrimidin-2-amine (PubChem CID 166658139) has the molecular formula C21H19ClN6 and a molecular weight of 390.88 g/mol. Its IUPAC name is 8-chloro-6-[2-methyl-5-(methylamino)phenyl]-N-(6-methyl-3-pyridinyl)pyrido[3,4-d]pyrimidin-2-amine.
| Compound Name | 8-chloro-6-[2-methyl-5-(methylamino)phenyl]-N-(6-methyl-3-pyridinyl)pyrido[3,4-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 166658139 |
| Molecular Formula | C21H19ClN6 |
| Molecular Weight | 390.88 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 8-chloro-6-[2-methyl-5-(methylamino)phenyl]-N-(6-methyl-3-pyridinyl)pyrido[3,4-d]pyrimidin-2-amine |
| SMILES | CNc1ccc(C)c(-c2cc3cnc(Nc4ccc(C)nc4)nc3c(Cl)n2)c1 |
| InChI | InChI=1S/C21H19ClN6/c1-12-4-6-15(23-3)9-17(12)18-8-14-10-25-21(28-19(14)20(22)27-18)26-16-7-5-13(2)24-11-16/h4-11,23H,1-3H3,(H,25,26,28) |
| InChIKey | OYASMGADZKYALO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.88 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|