About methyl 2-[[(E)-4-ethoxy-4-hydroxybut-2-enoyl]amino]-5-phenyl-1,3-thiazole-4-carboxylate
methyl 2-[[(E)-4-ethoxy-4-hydroxybut-2-enoyl]amino]-5-phenyl-1,3-thiazole-4-carboxylate (PubChem CID 166658387) has the molecular formula C17H18N2O5S
and a molecular weight of 362.41 g/mol. Its IUPAC name is methyl 2-[[(E)-4-ethoxy-4-hydroxybut-2-enoyl]amino]-5-phenyl-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[[(E)-4-ethoxy-4-hydroxybut-2-enoyl]amino]-5-phenyl-1,3-thiazole-4-carboxylate |
| PubChem CID | 166658387 |
| Molecular Formula | C17H18N2O5S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | methyl 2-[[(E)-4-ethoxy-4-hydroxybut-2-enoyl]amino]-5-phenyl-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(O)/C=C/C(=O)Nc1nc(C(=O)OC)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C17H18N2O5S/c1-3-24-13(21)10-9-12(20)18-17-19-14(16(22)23-2)15(25-17)11-7-5-4-6-8-11/h4-10,13,21H,3H2,1-2H3,(H,18,19,20)/b10-9+ |
| InChIKey | DVMAYAXMFCSPJM-MDZDMXLPSA-N |
| XLogP | 2.45 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[[(E)-4-ethoxy-4-hydroxybut-2-enoyl]amino]-5-phenyl-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[(E)-4-ethoxy-4-hydroxybut-2-enoyl]amino]-5-phenyl-1,3-thiazole-4-carboxylate?
The IUPAC name of methyl 2-[[(E)-4-ethoxy-4-hydroxybut-2-enoyl]amino]-5-phenyl-1,3-thiazole-4-carboxylate (CID 166658387) is methyl 2-[[(E)-4-ethoxy-4-hydroxybut-2-enoyl]amino]-5-phenyl-1,3-thiazole-4-carboxylate.
What is the SMILES notation for methyl 2-[[(E)-4-ethoxy-4-hydroxybut-2-enoyl]amino]-5-phenyl-1,3-thiazole-4-carboxylate?
The canonical SMILES for methyl 2-[[(E)-4-ethoxy-4-hydroxybut-2-enoyl]amino]-5-phenyl-1,3-thiazole-4-carboxylate is CCOC(O)/C=C/C(=O)Nc1nc(C(=O)OC)c(-c2ccccc2)s1.
What is the InChIKey of methyl 2-[[(E)-4-ethoxy-4-hydroxybut-2-enoyl]amino]-5-phenyl-1,3-thiazole-4-carboxylate?
The InChIKey is DVMAYAXMFCSPJM-MDZDMXLPSA-N. The full InChI is InChI=1S/C17H18N2O5S/c1-3-24-13(21)10-9-12(20)18-17-19-14(16(22)23-2)15(25-17)11-7-5-4-6-8-11/h4-10,13,21H,3H2,1-2H3,(H,18,19,20)/b10-9+.
What are the key properties of methyl 2-[[(E)-4-ethoxy-4-hydroxybut-2-enoyl]amino]-5-phenyl-1,3-thiazole-4-carboxylate?
methyl 2-[[(E)-4-ethoxy-4-hydroxybut-2-enoyl]amino]-5-phenyl-1,3-thiazole-4-carboxylate has a molecular weight of 362.41 g/mol, XLogP of 2.45, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[(E)-4-ethoxy-4-hydroxybut-2-enoyl]amino]-5-phenyl-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 166658387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).