About 2,2-difluoro-4-methyl-N,N-dipropylpent-4-enamide
2,2-difluoro-4-methyl-N,N-dipropylpent-4-enamide (PubChem CID 166658656) has the molecular formula C12H21F2NO
and a molecular weight of 233.30 g/mol. Its IUPAC name is 2,2-difluoro-4-methyl-N,N-dipropylpent-4-enamide.
Molecular Properties
| Compound Name | 2,2-difluoro-4-methyl-N,N-dipropylpent-4-enamide |
| PubChem CID | 166658656 |
| Molecular Formula | C12H21F2NO |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 2,2-difluoro-4-methyl-N,N-dipropylpent-4-enamide |
| SMILES | CCCN(CCC)C(=O)C(CC(=C)C)(F)F |
| InChI | InChI=1S/C12H21F2NO/c1-5-7-15(8-6-2)11(16)12(13,14)9-10(3)4/h3,5-9H2,1-2,4H3 |
| InChIKey | OLUQCCFNRSSOPF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 20.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | 245 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoro-4-methyl-N,N-dipropylpent-4-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-4-methyl-N,N-dipropylpent-4-enamide?
The IUPAC name of 2,2-difluoro-4-methyl-N,N-dipropylpent-4-enamide (CID 166658656) is 2,2-difluoro-4-methyl-N,N-dipropylpent-4-enamide.
What is the SMILES notation for 2,2-difluoro-4-methyl-N,N-dipropylpent-4-enamide?
The canonical SMILES for 2,2-difluoro-4-methyl-N,N-dipropylpent-4-enamide is CCCN(CCC)C(=O)C(CC(=C)C)(F)F.
What is the InChIKey of 2,2-difluoro-4-methyl-N,N-dipropylpent-4-enamide?
The InChIKey is OLUQCCFNRSSOPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F2NO/c1-5-7-15(8-6-2)11(16)12(13,14)9-10(3)4/h3,5-9H2,1-2,4H3.
What are the key properties of 2,2-difluoro-4-methyl-N,N-dipropylpent-4-enamide?
2,2-difluoro-4-methyl-N,N-dipropylpent-4-enamide has a molecular weight of 233.30 g/mol, XLogP of 3.90, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-4-methyl-N,N-dipropylpent-4-enamide is sourced from PubChem (CID 166658656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).