C19H16Cl2N4O2 — CID 166658677
N-[1-(3,4-dichlorophenyl)ethyl]-8-oxo-2,7,10-triazatricyclo[7.4.0.03,7]trideca-1(9),2,10,12-tetraene-12-carboxamide (PubChem CID 166658677) has the molecular formula C19H16Cl2N4O2 and a molecular weight of 403.27 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)ethyl]-8-oxo-2,7,10-triazatricyclo[7.4.0.03,7]trideca-1(9),2,10,12-tetraene-12-carboxamide.
| Compound Name | N-[1-(3,4-dichlorophenyl)ethyl]-8-oxo-2,7,10-triazatricyclo[7.4.0.03,7]trideca-1(9),2,10,12-tetraene-12-carboxamide |
|---|---|
| PubChem CID | 166658677 |
| Molecular Formula | C19H16Cl2N4O2 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)ethyl]-8-oxo-2,7,10-triazatricyclo[7.4.0.03,7]trideca-1(9),2,10,12-tetraene-12-carboxamide |
| SMILES | CC(NC(=O)c1cnc2c(=O)n3c(nc2c1)CCC3)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H16Cl2N4O2/c1-10(11-4-5-13(20)14(21)7-11)23-18(26)12-8-15-17(22-9-12)19(27)25-6-2-3-16(25)24-15/h4-5,7-10H,2-3,6H2,1H3,(H,23,26) |
| InChIKey | VSZVKQYNUMNFKY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |