About 3-[(1Z)-buta-1,3-dienyl]-2-methyl-4H-thieno[2,3-d]pyrimidine
3-[(1Z)-buta-1,3-dienyl]-2-methyl-4H-thieno[2,3-d]pyrimidine (PubChem CID 166658685) has the molecular formula C11H12N2S
and a molecular weight of 204.30 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-2-methyl-4H-thieno[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-2-methyl-4H-thieno[2,3-d]pyrimidine |
| PubChem CID | 166658685 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-2-methyl-4H-thieno[2,3-d]pyrimidine |
| SMILES | C=C/C=C\N1Cc2ccsc2N=C1C |
| InChI | InChI=1S/C11H12N2S/c1-3-4-6-13-8-10-5-7-14-11(10)12-9(13)2/h3-7H,1,8H2,2H3/b6-4- |
| InChIKey | CFLQWSLVRQMMCP-XQRVVYSFSA-N |
| XLogP | 3.31 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1Z)-buta-1,3-dienyl]-2-methyl-4H-thieno[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1Z)-buta-1,3-dienyl]-2-methyl-4H-thieno[2,3-d]pyrimidine?
The IUPAC name of 3-[(1Z)-buta-1,3-dienyl]-2-methyl-4H-thieno[2,3-d]pyrimidine (CID 166658685) is 3-[(1Z)-buta-1,3-dienyl]-2-methyl-4H-thieno[2,3-d]pyrimidine.
What is the SMILES notation for 3-[(1Z)-buta-1,3-dienyl]-2-methyl-4H-thieno[2,3-d]pyrimidine?
The canonical SMILES for 3-[(1Z)-buta-1,3-dienyl]-2-methyl-4H-thieno[2,3-d]pyrimidine is C=C/C=C\N1Cc2ccsc2N=C1C.
What is the InChIKey of 3-[(1Z)-buta-1,3-dienyl]-2-methyl-4H-thieno[2,3-d]pyrimidine?
The InChIKey is CFLQWSLVRQMMCP-XQRVVYSFSA-N. The full InChI is InChI=1S/C11H12N2S/c1-3-4-6-13-8-10-5-7-14-11(10)12-9(13)2/h3-7H,1,8H2,2H3/b6-4-.
What are the key properties of 3-[(1Z)-buta-1,3-dienyl]-2-methyl-4H-thieno[2,3-d]pyrimidine?
3-[(1Z)-buta-1,3-dienyl]-2-methyl-4H-thieno[2,3-d]pyrimidine has a molecular weight of 204.30 g/mol, XLogP of 3.31, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1Z)-buta-1,3-dienyl]-2-methyl-4H-thieno[2,3-d]pyrimidine is sourced from PubChem (CID 166658685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).