C20H18N6O3S2 — CID 166658766
5-[[2-[[4-(diethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 166658766) has the molecular formula C20H18N6O3S2 and a molecular weight of 454.54 g/mol. Its IUPAC name is 5-[[2-[[4-(diethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[2-[[4-(diethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 166658766 |
| Molecular Formula | C20H18N6O3S2 |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 5-[[2-[[4-(diethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CCN(CC)c1ccc(/N=N/c2nc3sc(C=C4C(=O)NC(=O)NC4=O)cc3s2)cc1 |
| InChI | InChI=1S/C20H18N6O3S2/c1-3-26(4-2)12-7-5-11(6-8-12)24-25-20-23-18-15(31-20)10-13(30-18)9-14-16(27)21-19(29)22-17(14)28/h5-10H,3-4H2,1-2H3,(H2,21,22,27,28,29)/b25-24+ |
| InChIKey | JUHINTMNVINPAW-OCOZRVBESA-N |
| XLogP | 4.37 |
| TPSA | 116.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|