C25H24ClNO3 — CID 166659093
[(2R)-2-(2-chlorophenyl)pyrrolidin-1-yl]-[4-[(2-methoxyphenoxy)methyl]phenyl]methanone (PubChem CID 166659093) has the molecular formula C25H24ClNO3 and a molecular weight of 421.92 g/mol. Its IUPAC name is [(2R)-2-(2-chlorophenyl)pyrrolidin-1-yl]-[4-[(2-methoxyphenoxy)methyl]phenyl]methanone.
| Compound Name | [(2R)-2-(2-chlorophenyl)pyrrolidin-1-yl]-[4-[(2-methoxyphenoxy)methyl]phenyl]methanone |
|---|---|
| PubChem CID | 166659093 |
| Molecular Formula | C25H24ClNO3 |
| Molecular Weight | 421.92 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | [(2R)-2-(2-chlorophenyl)pyrrolidin-1-yl]-[4-[(2-methoxyphenoxy)methyl]phenyl]methanone |
| SMILES | COc1ccccc1OCc1ccc(C(=O)N2CCC[C@@H]2c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C25H24ClNO3/c1-29-23-10-4-5-11-24(23)30-17-18-12-14-19(15-13-18)25(28)27-16-6-9-22(27)20-7-2-3-8-21(20)26/h2-5,7-8,10-15,22H,6,9,16-17H2,1H3/t22-/m1/s1 |
| InChIKey | DXKOIUSUCCWGHG-JOCHJYFZSA-N |
| XLogP | 5.90 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.92 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |