C15H23N — CID 166659852
(3Z,6Z)-5,5-dimethyl-3-[(3Z)-penta-1,3-dien-2-yl]octa-3,6-dien-2-imine (PubChem CID 166659852) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is (3Z,6Z)-5,5-dimethyl-3-[(3Z)-penta-1,3-dien-2-yl]octa-3,6-dien-2-imine.
| Compound Name | (3Z,6Z)-5,5-dimethyl-3-[(3Z)-penta-1,3-dien-2-yl]octa-3,6-dien-2-imine |
|---|---|
| PubChem CID | 166659852 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (3Z,6Z)-5,5-dimethyl-3-[(3Z)-penta-1,3-dien-2-yl]octa-3,6-dien-2-imine |
| SMILES | [H]/N=C(C)/C(=C\C(C)(C)/C=C\C)C(=C)/C=C\C |
| InChI | InChI=1S/C15H23N/c1-7-9-12(3)14(13(4)16)11-15(5,6)10-8-2/h7-11,16H,3H2,1-2,4-6H3/b9-7-,10-8-,14-11-,16-13+ |
| InChIKey | KUMLVQROKHCXCK-GFAXBMOZSA-N |
| XLogP | 4.69 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|