C12H8F15N — CID 166661056
1-[1,1,1,4,4,4-hexafluoro-3-(trifluoromethyl)but-2-en-2-yl]-3,5-bis(trifluoromethyl)piperidine (PubChem CID 166661056) has the molecular formula C12H8F15N and a molecular weight of 451.17 g/mol. Its IUPAC name is 1-[1,1,1,4,4,4-hexafluoro-3-(trifluoromethyl)but-2-en-2-yl]-3,5-bis(trifluoromethyl)piperidine.
| Compound Name | 1-[1,1,1,4,4,4-hexafluoro-3-(trifluoromethyl)but-2-en-2-yl]-3,5-bis(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 166661056 |
| Molecular Formula | C12H8F15N |
| Molecular Weight | 451.17 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | 1-[1,1,1,4,4,4-hexafluoro-3-(trifluoromethyl)but-2-en-2-yl]-3,5-bis(trifluoromethyl)piperidine |
| SMILES | FC(F)(F)C(=C(C(F)(F)F)C(F)(F)F)N1CC(C(F)(F)F)CC(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H8F15N/c13-8(14,15)4-1-5(9(16,17)18)3-28(2-4)7(12(25,26)27)6(10(19,20)21)11(22,23)24/h4-5H,1-3H2 |
| InChIKey | NXQUNJFDKFAWPA-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.17 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |