C21H16Cl2F4N6O7S — CID 166661761
1-[[2-[2,6-dichloro-4-[6-(difluoromethyl)-3,5-dioxo-1,2,4-triazin-2-yl]phenoxy]-5-hydroxy-4-pyridinyl]sulfonylamino]-N-(1,2-difluoroethyl)cyclopropane-1-carboxamide (PubChem CID 166661761) has the molecular formula C21H16Cl2F4N6O7S and a molecular weight of 643.36 g/mol. Its IUPAC name is 1-[[2-[2,6-dichloro-4-[6-(difluoromethyl)-3,5-dioxo-1,2,4-triazin-2-yl]phenoxy]-5-hydroxy-4-pyridinyl]sulfonylamino]-N-(1,2-difluoroethyl)cyclopropane-1-carboxamide.
| Compound Name | 1-[[2-[2,6-dichloro-4-[6-(difluoromethyl)-3,5-dioxo-1,2,4-triazin-2-yl]phenoxy]-5-hydroxy-4-pyridinyl]sulfonylamino]-N-(1,2-difluoroethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 166661761 |
| Molecular Formula | C21H16Cl2F4N6O7S |
| Molecular Weight | 643.36 g/mol |
| Exact Mass | 642.01 |
| IUPAC Name | 1-[[2-[2,6-dichloro-4-[6-(difluoromethyl)-3,5-dioxo-1,2,4-triazin-2-yl]phenoxy]-5-hydroxy-4-pyridinyl]sulfonylamino]-N-(1,2-difluoroethyl)cyclopropane-1-carboxamide |
| SMILES | O=C(NC(F)CF)C1(NS(=O)(=O)c2cc(Oc3c(Cl)cc(-n4nc(C(F)F)c(=O)[nH]c4=O)cc3Cl)ncc2O)CC1 |
| InChI | InChI=1S/C21H16Cl2F4N6O7S/c22-9-3-8(33-20(37)30-18(35)15(31-33)17(26)27)4-10(23)16(9)40-14-5-12(11(34)7-28-14)41(38,39)32-21(1-2-21)19(36)29-13(25)6-24/h3-5,7,13,17,32,34H,1-2,6H2,(H,29,36)(H,30,35,37) |
| InChIKey | POTGCOIWFSJVIT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 185.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|