C27H23Cl2F2N3O4S — CID 166661836
2-[3,5-dichloro-4-(3-ethylsulfanyl-7-methyl-4-phenylmethoxycyclohepta-1,3,5-trien-1-yl)oxyphenyl]-6-(difluoromethyl)-1,2,4-triazine-3,5-dione (PubChem CID 166661836) has the molecular formula C27H23Cl2F2N3O4S and a molecular weight of 594.47 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-(3-ethylsulfanyl-7-methyl-4-phenylmethoxycyclohepta-1,3,5-trien-1-yl)oxyphenyl]-6-(difluoromethyl)-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[3,5-dichloro-4-(3-ethylsulfanyl-7-methyl-4-phenylmethoxycyclohepta-1,3,5-trien-1-yl)oxyphenyl]-6-(difluoromethyl)-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 166661836 |
| Molecular Formula | C27H23Cl2F2N3O4S |
| Molecular Weight | 594.47 g/mol |
| Exact Mass | 593.08 |
| IUPAC Name | 2-[3,5-dichloro-4-(3-ethylsulfanyl-7-methyl-4-phenylmethoxycyclohepta-1,3,5-trien-1-yl)oxyphenyl]-6-(difluoromethyl)-1,2,4-triazine-3,5-dione |
| SMILES | CCSC1=C(OCc2ccccc2)C=CC(C)C(Oc2c(Cl)cc(-n3nc(C(F)F)c(=O)[nH]c3=O)cc2Cl)=C1 |
| InChI | InChI=1S/C27H23Cl2F2N3O4S/c1-3-39-22-13-21(15(2)9-10-20(22)37-14-16-7-5-4-6-8-16)38-24-18(28)11-17(12-19(24)29)34-27(36)32-26(35)23(33-34)25(30)31/h4-13,15,25H,3,14H2,1-2H3,(H,32,35,36) |
| InChIKey | SUMRPKUJDXMFIX-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.47 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |