C26H26O3 — CID 166661935
(3S,4R)-7-(oxan-2-yloxy)-3,4-diphenyl-3,4-dihydro-1H-isochromene (PubChem CID 166661935) has the molecular formula C26H26O3 and a molecular weight of 386.49 g/mol. Its IUPAC name is (3S,4R)-7-(oxan-2-yloxy)-3,4-diphenyl-3,4-dihydro-1H-isochromene.
| Compound Name | (3S,4R)-7-(oxan-2-yloxy)-3,4-diphenyl-3,4-dihydro-1H-isochromene |
|---|---|
| PubChem CID | 166661935 |
| Molecular Formula | C26H26O3 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | (3S,4R)-7-(oxan-2-yloxy)-3,4-diphenyl-3,4-dihydro-1H-isochromene |
| SMILES | c1ccc([C@@H]2c3ccc(OC4CCCCO4)cc3CO[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C26H26O3/c1-3-9-19(10-4-1)25-23-15-14-22(29-24-13-7-8-16-27-24)17-21(23)18-28-26(25)20-11-5-2-6-12-20/h1-6,9-12,14-15,17,24-26H,7-8,13,16,18H2/t24?,25-,26-/m1/s1 |
| InChIKey | SCHZPSRZCGSSQH-KPRFIHOGSA-N |
| XLogP | 6.00 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |