About 3-(1-methylpyrazol-4-yl)-N-(4-methylsulfonylphenyl)imidazo[1,2-a]pyrazin-8-amine
3-(1-methylpyrazol-4-yl)-N-(4-methylsulfonylphenyl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 16666225) has the molecular formula C17H16N6O2S
and a molecular weight of 368.42 g/mol. Its IUPAC name is 3-(1-methylpyrazol-4-yl)-N-(4-methylsulfonylphenyl)imidazo[1,2-a]pyrazin-8-amine.
Molecular Properties
| Compound Name | 3-(1-methylpyrazol-4-yl)-N-(4-methylsulfonylphenyl)imidazo[1,2-a]pyrazin-8-amine |
| PubChem CID | 16666225 |
| Molecular Formula | C17H16N6O2S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 3-(1-methylpyrazol-4-yl)-N-(4-methylsulfonylphenyl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | Cn1cc(-c2cnc3c(Nc4ccc(S(C)(=O)=O)cc4)nccn23)cn1 |
| InChI | InChI=1S/C17H16N6O2S/c1-22-11-12(9-20-22)15-10-19-17-16(18-7-8-23(15)17)21-13-3-5-14(6-4-13)26(2,24)25/h3-11H,1-2H3,(H,18,21) |
| InChIKey | ZXQRGHXNCAGOPZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-(1-methylpyrazol-4-yl)-N-(4-methylsulfonylphenyl)imidazo[1,2-a]pyrazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-methylpyrazol-4-yl)-N-(4-methylsulfonylphenyl)imidazo[1,2-a]pyrazin-8-amine?
The IUPAC name of 3-(1-methylpyrazol-4-yl)-N-(4-methylsulfonylphenyl)imidazo[1,2-a]pyrazin-8-amine (CID 16666225) is 3-(1-methylpyrazol-4-yl)-N-(4-methylsulfonylphenyl)imidazo[1,2-a]pyrazin-8-amine.
What is the SMILES notation for 3-(1-methylpyrazol-4-yl)-N-(4-methylsulfonylphenyl)imidazo[1,2-a]pyrazin-8-amine?
The canonical SMILES for 3-(1-methylpyrazol-4-yl)-N-(4-methylsulfonylphenyl)imidazo[1,2-a]pyrazin-8-amine is Cn1cc(-c2cnc3c(Nc4ccc(S(C)(=O)=O)cc4)nccn23)cn1.
What is the InChIKey of 3-(1-methylpyrazol-4-yl)-N-(4-methylsulfonylphenyl)imidazo[1,2-a]pyrazin-8-amine?
The InChIKey is ZXQRGHXNCAGOPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N6O2S/c1-22-11-12(9-20-22)15-10-19-17-16(18-7-8-23(15)17)21-13-3-5-14(6-4-13)26(2,24)25/h3-11H,1-2H3,(H,18,21).
What are the key properties of 3-(1-methylpyrazol-4-yl)-N-(4-methylsulfonylphenyl)imidazo[1,2-a]pyrazin-8-amine?
3-(1-methylpyrazol-4-yl)-N-(4-methylsulfonylphenyl)imidazo[1,2-a]pyrazin-8-amine has a molecular weight of 368.42 g/mol, XLogP of 2.28, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-methylpyrazol-4-yl)-N-(4-methylsulfonylphenyl)imidazo[1,2-a]pyrazin-8-amine is sourced from PubChem (CID 16666225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).