C14H15ClFN3O3 — CID 166662493
methyl 3-(2-chloro-4-fluoro-5-hydrazinylphenyl)-3a,4,5,6-tetrahydrocyclopenta[d][1,2]oxazole-6a-carboxylate (PubChem CID 166662493) has the molecular formula C14H15ClFN3O3 and a molecular weight of 327.74 g/mol. Its IUPAC name is methyl 3-(2-chloro-4-fluoro-5-hydrazinylphenyl)-3a,4,5,6-tetrahydrocyclopenta[d][1,2]oxazole-6a-carboxylate.
| Compound Name | methyl 3-(2-chloro-4-fluoro-5-hydrazinylphenyl)-3a,4,5,6-tetrahydrocyclopenta[d][1,2]oxazole-6a-carboxylate |
|---|---|
| PubChem CID | 166662493 |
| Molecular Formula | C14H15ClFN3O3 |
| Molecular Weight | 327.74 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | methyl 3-(2-chloro-4-fluoro-5-hydrazinylphenyl)-3a,4,5,6-tetrahydrocyclopenta[d][1,2]oxazole-6a-carboxylate |
| SMILES | COC(=O)C12CCCC1C(c1cc(NN)c(F)cc1Cl)=NO2 |
| InChI | InChI=1S/C14H15ClFN3O3/c1-21-13(20)14-4-2-3-8(14)12(19-22-14)7-5-11(18-17)10(16)6-9(7)15/h5-6,8,18H,2-4,17H2,1H3 |
| InChIKey | IUNIXKWZNMVSGU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.74 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|