C11H14F2N2O3 — CID 166662522
[(E)-1,1-difluoropropan-2-ylideneamino] 3-methyl-3a,4,5,6-tetrahydrocyclopenta[d][1,2]oxazole-6a-carboxylate (PubChem CID 166662522) has the molecular formula C11H14F2N2O3 and a molecular weight of 260.24 g/mol. Its IUPAC name is [(E)-1,1-difluoropropan-2-ylideneamino] 3-methyl-3a,4,5,6-tetrahydrocyclopenta[d][1,2]oxazole-6a-carboxylate.
| Compound Name | [(E)-1,1-difluoropropan-2-ylideneamino] 3-methyl-3a,4,5,6-tetrahydrocyclopenta[d][1,2]oxazole-6a-carboxylate |
|---|---|
| PubChem CID | 166662522 |
| Molecular Formula | C11H14F2N2O3 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | [(E)-1,1-difluoropropan-2-ylideneamino] 3-methyl-3a,4,5,6-tetrahydrocyclopenta[d][1,2]oxazole-6a-carboxylate |
| SMILES | CC1=NOC2(C(=O)O/N=C(\C)C(F)F)CCCC12 |
| InChI | InChI=1S/C11H14F2N2O3/c1-6-8-4-3-5-11(8,18-15-6)10(16)17-14-7(2)9(12)13/h8-9H,3-5H2,1-2H3/b14-7+ |
| InChIKey | DOVGJFLCRFVWJO-VGOFMYFVSA-N |
| XLogP | 2.12 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|