C11H14F3NO3 — CID 166662532
3,3,3-trifluoropropyl 3-methyl-3a,4,5,6-tetrahydrocyclopenta[d][1,2]oxazole-6a-carboxylate (PubChem CID 166662532) has the molecular formula C11H14F3NO3 and a molecular weight of 265.23 g/mol. Its IUPAC name is 3,3,3-trifluoropropyl 3-methyl-3a,4,5,6-tetrahydrocyclopenta[d][1,2]oxazole-6a-carboxylate.
| Compound Name | 3,3,3-trifluoropropyl 3-methyl-3a,4,5,6-tetrahydrocyclopenta[d][1,2]oxazole-6a-carboxylate |
|---|---|
| PubChem CID | 166662532 |
| Molecular Formula | C11H14F3NO3 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 3,3,3-trifluoropropyl 3-methyl-3a,4,5,6-tetrahydrocyclopenta[d][1,2]oxazole-6a-carboxylate |
| SMILES | CC1=NOC2(C(=O)OCCC(F)(F)F)CCCC12 |
| InChI | InChI=1S/C11H14F3NO3/c1-7-8-3-2-4-10(8,18-15-7)9(16)17-6-5-11(12,13)14/h8H,2-6H2,1H3 |
| InChIKey | LBRMQWILVVWPTO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |