About 3,6-dimethyl-2-(4-propan-2-ylphenyl)-4,5-dihydrooxepine
3,6-dimethyl-2-(4-propan-2-ylphenyl)-4,5-dihydrooxepine (PubChem CID 166662816) has the molecular formula C17H22O
and a molecular weight of 242.36 g/mol. Its IUPAC name is 3,6-dimethyl-2-(4-propan-2-ylphenyl)-4,5-dihydrooxepine.
Molecular Properties
| Compound Name | 3,6-dimethyl-2-(4-propan-2-ylphenyl)-4,5-dihydrooxepine |
| PubChem CID | 166662816 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 3,6-dimethyl-2-(4-propan-2-ylphenyl)-4,5-dihydrooxepine |
| SMILES | CC1=COC(c2ccc(C(C)C)cc2)=C(C)CC1 |
| InChI | InChI=1S/C17H22O/c1-12(2)15-7-9-16(10-8-15)17-14(4)6-5-13(3)11-18-17/h7-12H,5-6H2,1-4H3 |
| InChIKey | ORKJTGANNFMNHI-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,6-dimethyl-2-(4-propan-2-ylphenyl)-4,5-dihydrooxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-2-(4-propan-2-ylphenyl)-4,5-dihydrooxepine?
The IUPAC name of 3,6-dimethyl-2-(4-propan-2-ylphenyl)-4,5-dihydrooxepine (CID 166662816) is 3,6-dimethyl-2-(4-propan-2-ylphenyl)-4,5-dihydrooxepine.
What is the SMILES notation for 3,6-dimethyl-2-(4-propan-2-ylphenyl)-4,5-dihydrooxepine?
The canonical SMILES for 3,6-dimethyl-2-(4-propan-2-ylphenyl)-4,5-dihydrooxepine is CC1=COC(c2ccc(C(C)C)cc2)=C(C)CC1.
What is the InChIKey of 3,6-dimethyl-2-(4-propan-2-ylphenyl)-4,5-dihydrooxepine?
The InChIKey is ORKJTGANNFMNHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22O/c1-12(2)15-7-9-16(10-8-15)17-14(4)6-5-13(3)11-18-17/h7-12H,5-6H2,1-4H3.
What are the key properties of 3,6-dimethyl-2-(4-propan-2-ylphenyl)-4,5-dihydrooxepine?
3,6-dimethyl-2-(4-propan-2-ylphenyl)-4,5-dihydrooxepine has a molecular weight of 242.36 g/mol, XLogP of 5.26, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-2-(4-propan-2-ylphenyl)-4,5-dihydrooxepine is sourced from PubChem (CID 166662816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).