C15H10N4 — CID 166662907
3-ethenyl-6-propan-2-ylbenzene-1,2,4,5-tetracarbonitrile (PubChem CID 166662907) has the molecular formula C15H10N4 and a molecular weight of 246.27 g/mol. Its IUPAC name is 3-ethenyl-6-propan-2-ylbenzene-1,2,4,5-tetracarbonitrile.
| Compound Name | 3-ethenyl-6-propan-2-ylbenzene-1,2,4,5-tetracarbonitrile |
|---|---|
| PubChem CID | 166662907 |
| Molecular Formula | C15H10N4 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 3-ethenyl-6-propan-2-ylbenzene-1,2,4,5-tetracarbonitrile |
| SMILES | C=Cc1c(C#N)c(C#N)c(C(C)C)c(C#N)c1C#N |
| InChI | InChI=1S/C15H10N4/c1-4-10-11(5-16)13(7-18)15(9(2)3)14(8-19)12(10)6-17/h4,9H,1H2,2-3H3 |
| InChIKey | GHDTWAPSMFSECY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |