About 3,3-dimethyl-5-propan-2-yl-6-[(Z)-prop-1-enyl]-4,5-dihydro-2H-pyridine
3,3-dimethyl-5-propan-2-yl-6-[(Z)-prop-1-enyl]-4,5-dihydro-2H-pyridine (PubChem CID 166663027) has the molecular formula C13H23N
and a molecular weight of 193.33 g/mol. Its IUPAC name is 3,3-dimethyl-5-propan-2-yl-6-[(Z)-prop-1-enyl]-4,5-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 3,3-dimethyl-5-propan-2-yl-6-[(Z)-prop-1-enyl]-4,5-dihydro-2H-pyridine |
| PubChem CID | 166663027 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 3,3-dimethyl-5-propan-2-yl-6-[(Z)-prop-1-enyl]-4,5-dihydro-2H-pyridine |
| SMILES | C/C=C\C1=NCC(C)(C)CC1C(C)C |
| InChI | InChI=1S/C13H23N/c1-6-7-12-11(10(2)3)8-13(4,5)9-14-12/h6-7,10-11H,8-9H2,1-5H3/b7-6- |
| InChIKey | RGRZYJQBDRFSJE-SREVYHEPSA-N |
| XLogP | 3.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-dimethyl-5-propan-2-yl-6-[(Z)-prop-1-enyl]-4,5-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-5-propan-2-yl-6-[(Z)-prop-1-enyl]-4,5-dihydro-2H-pyridine?
The IUPAC name of 3,3-dimethyl-5-propan-2-yl-6-[(Z)-prop-1-enyl]-4,5-dihydro-2H-pyridine (CID 166663027) is 3,3-dimethyl-5-propan-2-yl-6-[(Z)-prop-1-enyl]-4,5-dihydro-2H-pyridine.
What is the SMILES notation for 3,3-dimethyl-5-propan-2-yl-6-[(Z)-prop-1-enyl]-4,5-dihydro-2H-pyridine?
The canonical SMILES for 3,3-dimethyl-5-propan-2-yl-6-[(Z)-prop-1-enyl]-4,5-dihydro-2H-pyridine is C/C=C\C1=NCC(C)(C)CC1C(C)C.
What is the InChIKey of 3,3-dimethyl-5-propan-2-yl-6-[(Z)-prop-1-enyl]-4,5-dihydro-2H-pyridine?
The InChIKey is RGRZYJQBDRFSJE-SREVYHEPSA-N. The full InChI is InChI=1S/C13H23N/c1-6-7-12-11(10(2)3)8-13(4,5)9-14-12/h6-7,10-11H,8-9H2,1-5H3/b7-6-.
What are the key properties of 3,3-dimethyl-5-propan-2-yl-6-[(Z)-prop-1-enyl]-4,5-dihydro-2H-pyridine?
3,3-dimethyl-5-propan-2-yl-6-[(Z)-prop-1-enyl]-4,5-dihydro-2H-pyridine has a molecular weight of 193.33 g/mol, XLogP of 3.71, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-5-propan-2-yl-6-[(Z)-prop-1-enyl]-4,5-dihydro-2H-pyridine is sourced from PubChem (CID 166663027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).