C21H22O9 — CID 166663327
2-(3,4-dihydroxyphenyl)-5-hydroxy-7-[4-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one (PubChem CID 166663327) has the molecular formula C21H22O9 and a molecular weight of 418.40 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-[4-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-[4-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 166663327 |
| Molecular Formula | C21H22O9 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-[4-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
| SMILES | O=C1CC(c2ccc(O)c(O)c2)Oc2cc(OC3CC(O)CC(CO)O3)cc(O)c21 |
| InChI | InChI=1S/C21H22O9/c22-9-13-4-11(23)5-20(29-13)28-12-6-16(26)21-17(27)8-18(30-19(21)7-12)10-1-2-14(24)15(25)3-10/h1-3,6-7,11,13,18,20,22-26H,4-5,8-9H2 |
| InChIKey | JUWMWEKVLATWEX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|