C23H20ClN7O — CID 166664239
3-amino-6-(2-chloro-6-methyl-4-pyridinyl)-5-phenyl-N-(1-pyrimidin-4-ylethyl)pyrazine-2-carboxamide (PubChem CID 166664239) has the molecular formula C23H20ClN7O and a molecular weight of 445.91 g/mol. Its IUPAC name is 3-amino-6-(2-chloro-6-methyl-4-pyridinyl)-5-phenyl-N-(1-pyrimidin-4-ylethyl)pyrazine-2-carboxamide.
| Compound Name | 3-amino-6-(2-chloro-6-methyl-4-pyridinyl)-5-phenyl-N-(1-pyrimidin-4-ylethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 166664239 |
| Molecular Formula | C23H20ClN7O |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 3-amino-6-(2-chloro-6-methyl-4-pyridinyl)-5-phenyl-N-(1-pyrimidin-4-ylethyl)pyrazine-2-carboxamide |
| SMILES | Cc1cc(-c2nc(C(=O)NC(C)c3ccncn3)c(N)nc2-c2ccccc2)cc(Cl)n1 |
| InChI | InChI=1S/C23H20ClN7O/c1-13-10-16(11-18(24)28-13)20-19(15-6-4-3-5-7-15)31-22(25)21(30-20)23(32)29-14(2)17-8-9-26-12-27-17/h3-12,14H,1-2H3,(H2,25,31)(H,29,32) |
| InChIKey | QGUFUYQYPYLUPU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|