C32H39ClN2O5S — CID 166665107
(4S)-7-chloro-5'-[[(1R,2S)-2-(2-hydroxypent-4-enyl)cyclobutyl]methyl]-N-prop-2-enylsulfonylspiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxamide (PubChem CID 166665107) has the molecular formula C32H39ClN2O5S and a molecular weight of 599.19 g/mol. Its IUPAC name is (4S)-7-chloro-5'-[[(1R,2S)-2-(2-hydroxypent-4-enyl)cyclobutyl]methyl]-N-prop-2-enylsulfonylspiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxamide.
| Compound Name | (4S)-7-chloro-5'-[[(1R,2S)-2-(2-hydroxypent-4-enyl)cyclobutyl]methyl]-N-prop-2-enylsulfonylspiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxamide |
|---|---|
| PubChem CID | 166665107 |
| Molecular Formula | C32H39ClN2O5S |
| Molecular Weight | 599.19 g/mol |
| Exact Mass | 598.23 |
| IUPAC Name | (4S)-7-chloro-5'-[[(1R,2S)-2-(2-hydroxypent-4-enyl)cyclobutyl]methyl]-N-prop-2-enylsulfonylspiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxamide |
| SMILES | C=CCC(O)C[C@@H]1CC[C@H]1CN1C[C@@]2(CCCc3cc(Cl)ccc32)COc2ccc(C(=O)NS(=O)(=O)CC=C)cc21 |
| InChI | InChI=1S/C32H39ClN2O5S/c1-3-6-27(36)17-22-8-9-25(22)19-35-20-32(14-5-7-23-16-26(33)11-12-28(23)32)21-40-30-13-10-24(18-29(30)35)31(37)34-41(38,39)15-4-2/h3-4,10-13,16,18,22,25,27,36H,1-2,5-9,14-15,17,19-21H2,(H,34,37)/t22-,25-,27?,32-/m0/s1 |
| InChIKey | YORSJBBCFKDOPU-UXZWVLQVSA-N |
| XLogP | 5.41 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.19 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|