C32H39ClN2O5S — CID 166665199
(3S)-6-chloro-N-hex-5-en-2-ylsulfonyl-5'-[[(1R,2R)-2-(1-hydroxyprop-2-enyl)cyclobutyl]methyl]spiro[1,2-dihydroindene-3,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxamide (PubChem CID 166665199) has the molecular formula C32H39ClN2O5S and a molecular weight of 599.19 g/mol. Its IUPAC name is (3S)-6-chloro-N-hex-5-en-2-ylsulfonyl-5'-[[(1R,2R)-2-(1-hydroxyprop-2-enyl)cyclobutyl]methyl]spiro[1,2-dihydroindene-3,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxamide.
| Compound Name | (3S)-6-chloro-N-hex-5-en-2-ylsulfonyl-5'-[[(1R,2R)-2-(1-hydroxyprop-2-enyl)cyclobutyl]methyl]spiro[1,2-dihydroindene-3,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxamide |
|---|---|
| PubChem CID | 166665199 |
| Molecular Formula | C32H39ClN2O5S |
| Molecular Weight | 599.19 g/mol |
| Exact Mass | 598.23 |
| IUPAC Name | (3S)-6-chloro-N-hex-5-en-2-ylsulfonyl-5'-[[(1R,2R)-2-(1-hydroxyprop-2-enyl)cyclobutyl]methyl]spiro[1,2-dihydroindene-3,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxamide |
| SMILES | C=CCCC(C)S(=O)(=O)NC(=O)c1ccc2c(c1)N(C[C@@H]1CC[C@H]1C(O)C=C)C[C@@]1(CCc3cc(Cl)ccc31)CO2 |
| InChI | InChI=1S/C32H39ClN2O5S/c1-4-6-7-21(3)41(38,39)34-31(37)23-9-13-30-28(17-23)35(18-24-8-11-26(24)29(36)5-2)19-32(20-40-30)15-14-22-16-25(33)10-12-27(22)32/h4-5,9-10,12-13,16-17,21,24,26,29,36H,1-2,6-8,11,14-15,18-20H2,3H3,(H,34,37)/t21?,24-,26+,29?,32-/m0/s1 |
| InChIKey | BVBALCBMBARHIA-RLMXSNDNSA-N |
| XLogP | 5.41 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.19 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|