C19H26NO8P — CID 16666595
2,3-dihydroxypropyl [(12S,14R)-14-hydroxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-9-yl] hydrogen phosphate (PubChem CID 16666595) has the molecular formula C19H26NO8P and a molecular weight of 427.39 g/mol. Its IUPAC name is 2,3-dihydroxypropyl [(12S,14R)-14-hydroxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-9-yl] hydrogen phosphate.
| Compound Name | 2,3-dihydroxypropyl [(12S,14R)-14-hydroxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-9-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 16666595 |
| Molecular Formula | C19H26NO8P |
| Molecular Weight | 427.39 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 2,3-dihydroxypropyl [(12S,14R)-14-hydroxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-9-yl] hydrogen phosphate |
| SMILES | CN1CCC23C=C[C@H](O)C[C@@H]2Oc2c(OP(=O)(O)OCC(O)CO)ccc(c23)C1 |
| InChI | InChI=1S/C19H26NO8P/c1-20-7-6-19-5-4-13(22)8-16(19)27-18-15(3-2-12(9-20)17(18)19)28-29(24,25)26-11-14(23)10-21/h2-5,13-14,16,21-23H,6-11H2,1H3,(H,24,25)/t13-,14?,16-,19?/m0/s1 |
| InChIKey | FXGMGECJHUOCIS-ZTCUZBCZSA-N |
| XLogP | 0.69 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.39 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|