C25H30Cl2N2O3 — CID 166666713
2,7-bis(2-aminopropan-2-yl)-9-(3,4-dichlorophenyl)-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione (PubChem CID 166666713) has the molecular formula C25H30Cl2N2O3 and a molecular weight of 477.43 g/mol. Its IUPAC name is 2,7-bis(2-aminopropan-2-yl)-9-(3,4-dichlorophenyl)-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione.
| Compound Name | 2,7-bis(2-aminopropan-2-yl)-9-(3,4-dichlorophenyl)-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 166666713 |
| Molecular Formula | C25H30Cl2N2O3 |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 2,7-bis(2-aminopropan-2-yl)-9-(3,4-dichlorophenyl)-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
| SMILES | CC(C)(N)C1CCC2=C(C1=O)C(c1ccc(Cl)c(Cl)c1)C1=C(CCC(C(C)(C)N)C1=O)O2 |
| InChI | InChI=1S/C25H30Cl2N2O3/c1-24(2,28)13-6-9-17-20(22(13)30)19(12-5-8-15(26)16(27)11-12)21-18(32-17)10-7-14(23(21)31)25(3,4)29/h5,8,11,13-14,19H,6-7,9-10,28-29H2,1-4H3 |
| InChIKey | DQRYJCFBDJKHGD-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |