C28H27F8N3O5 — CID 166666921
N-(1-cyanocyclopropyl)-2-[[1-[8-(2,2-difluoro-1-hydroxyethyl)dibenzofuran-3-yl]-2,2,2-trifluoroethyl]amino]-4-methylpentanamide;2,2,2-trifluoroacetic acid (PubChem CID 166666921) has the molecular formula C28H27F8N3O5 and a molecular weight of 637.52 g/mol. Its IUPAC name is N-(1-cyanocyclopropyl)-2-[[1-[8-(2,2-difluoro-1-hydroxyethyl)dibenzofuran-3-yl]-2,2,2-trifluoroethyl]amino]-4-methylpentanamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(1-cyanocyclopropyl)-2-[[1-[8-(2,2-difluoro-1-hydroxyethyl)dibenzofuran-3-yl]-2,2,2-trifluoroethyl]amino]-4-methylpentanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166666921 |
| Molecular Formula | C28H27F8N3O5 |
| Molecular Weight | 637.52 g/mol |
| Exact Mass | 637.18 |
| IUPAC Name | N-(1-cyanocyclopropyl)-2-[[1-[8-(2,2-difluoro-1-hydroxyethyl)dibenzofuran-3-yl]-2,2,2-trifluoroethyl]amino]-4-methylpentanamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)CC(NC(c1ccc2c(c1)oc1ccc(C(O)C(F)F)cc12)C(F)(F)F)C(=O)NC1(C#N)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H26F5N3O3.C2HF3O2/c1-13(2)9-18(24(36)34-25(12-32)7-8-25)33-22(26(29,30)31)15-3-5-16-17-10-14(21(35)23(27)28)4-6-19(17)37-20(16)11-15;3-2(4,5)1(6)7/h3-6,10-11,13,18,21-23,33,35H,7-9H2,1-2H3,(H,34,36);(H,6,7) |
| InChIKey | MIFFHHKFKHDGEY-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 135.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.52 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |