About 7-fluoro-1-iodo-4,4-dimethyl-2H-quinolin-3-one
7-fluoro-1-iodo-4,4-dimethyl-2H-quinolin-3-one (PubChem CID 166667213) has the molecular formula C11H11FINO
and a molecular weight of 319.12 g/mol. Its IUPAC name is 7-fluoro-1-iodo-4,4-dimethyl-2H-quinolin-3-one.
Molecular Properties
| Compound Name | 7-fluoro-1-iodo-4,4-dimethyl-2H-quinolin-3-one |
| PubChem CID | 166667213 |
| Molecular Formula | C11H11FINO |
| Molecular Weight | 319.12 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | 7-fluoro-1-iodo-4,4-dimethyl-2H-quinolin-3-one |
| SMILES | CC1(C)C(=O)CN(I)c2cc(F)ccc21 |
| InChI | InChI=1S/C11H11FINO/c1-11(2)8-4-3-7(12)5-9(8)14(13)6-10(11)15/h3-5H,6H2,1-2H3 |
| InChIKey | CWZFMYRARHMMLW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.12 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-1-iodo-4,4-dimethyl-2H-quinolin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-1-iodo-4,4-dimethyl-2H-quinolin-3-one?
The IUPAC name of 7-fluoro-1-iodo-4,4-dimethyl-2H-quinolin-3-one (CID 166667213) is 7-fluoro-1-iodo-4,4-dimethyl-2H-quinolin-3-one.
What is the SMILES notation for 7-fluoro-1-iodo-4,4-dimethyl-2H-quinolin-3-one?
The canonical SMILES for 7-fluoro-1-iodo-4,4-dimethyl-2H-quinolin-3-one is CC1(C)C(=O)CN(I)c2cc(F)ccc21.
What is the InChIKey of 7-fluoro-1-iodo-4,4-dimethyl-2H-quinolin-3-one?
The InChIKey is CWZFMYRARHMMLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FINO/c1-11(2)8-4-3-7(12)5-9(8)14(13)6-10(11)15/h3-5H,6H2,1-2H3.
What are the key properties of 7-fluoro-1-iodo-4,4-dimethyl-2H-quinolin-3-one?
7-fluoro-1-iodo-4,4-dimethyl-2H-quinolin-3-one has a molecular weight of 319.12 g/mol, XLogP of 2.84, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-1-iodo-4,4-dimethyl-2H-quinolin-3-one is sourced from PubChem (CID 166667213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).