About 1-aminopropan-2-ol;5-methyl-3-[(5-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine
1-aminopropan-2-ol;5-methyl-3-[(5-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine (PubChem CID 166667220) has the molecular formula C12H27N3O3
and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-aminopropan-2-ol;5-methyl-3-[(5-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine.
Molecular Properties
| Compound Name | 1-aminopropan-2-ol;5-methyl-3-[(5-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine |
| PubChem CID | 166667220 |
| Molecular Formula | C12H27N3O3 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 1-aminopropan-2-ol;5-methyl-3-[(5-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine |
| SMILES | CC(O)CN.CC1CN(CN2COC(C)C2)CO1 |
| InChI | InChI=1S/C9H18N2O2.C3H9NO/c1-8-3-10(6-12-8)5-11-4-9(2)13-7-11;1-3(5)2-4/h8-9H,3-7H2,1-2H3;3,5H,2,4H2,1H3 |
| InChIKey | PFBFXATWKPDWAA-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-aminopropan-2-ol;5-methyl-3-[(5-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopropan-2-ol;5-methyl-3-[(5-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine?
The IUPAC name of 1-aminopropan-2-ol;5-methyl-3-[(5-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine (CID 166667220) is 1-aminopropan-2-ol;5-methyl-3-[(5-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine.
What is the SMILES notation for 1-aminopropan-2-ol;5-methyl-3-[(5-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine?
The canonical SMILES for 1-aminopropan-2-ol;5-methyl-3-[(5-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine is CC(O)CN.CC1CN(CN2COC(C)C2)CO1.
What is the InChIKey of 1-aminopropan-2-ol;5-methyl-3-[(5-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine?
The InChIKey is PFBFXATWKPDWAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2.C3H9NO/c1-8-3-10(6-12-8)5-11-4-9(2)13-7-11;1-3(5)2-4/h8-9H,3-7H2,1-2H3;3,5H,2,4H2,1H3.
What are the key properties of 1-aminopropan-2-ol;5-methyl-3-[(5-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine?
1-aminopropan-2-ol;5-methyl-3-[(5-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine has a molecular weight of 261.37 g/mol, XLogP of -0.37, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopropan-2-ol;5-methyl-3-[(5-methyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine is sourced from PubChem (CID 166667220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).