C47H84N2O5 — CID 166667770
1-O-(3-butylhepta-4,5,6-trienyl) 21-O-(3-methylheptyl) 11-[(2-piperidin-1-ylacetyl)amino]henicosanedioate (PubChem CID 166667770) has the molecular formula C47H84N2O5 and a molecular weight of 757.20 g/mol. Its IUPAC name is 1-O-(3-butylhepta-4,5,6-trienyl) 21-O-(3-methylheptyl) 11-[(2-piperidin-1-ylacetyl)amino]henicosanedioate.
| Compound Name | 1-O-(3-butylhepta-4,5,6-trienyl) 21-O-(3-methylheptyl) 11-[(2-piperidin-1-ylacetyl)amino]henicosanedioate |
|---|---|
| PubChem CID | 166667770 |
| Molecular Formula | C47H84N2O5 |
| Molecular Weight | 757.20 g/mol |
| Exact Mass | 756.64 |
| IUPAC Name | 1-O-(3-butylhepta-4,5,6-trienyl) 21-O-(3-methylheptyl) 11-[(2-piperidin-1-ylacetyl)amino]henicosanedioate |
| SMILES | C=C=C=CC(CCCC)CCOC(=O)CCCCCCCCCC(CCCCCCCCCC(=O)OCCC(C)CCCC)NC(=O)CN1CCCCC1 |
| InChI | InChI=1S/C47H84N2O5/c1-5-8-28-42(4)35-39-53-46(51)33-24-19-15-11-13-17-22-31-44(48-45(50)41-49-37-26-21-27-38-49)32-23-18-14-12-16-20-25-34-47(52)54-40-36-43(29-9-6-2)30-10-7-3/h29,42-44H,2,5,7-8,10-28,30-41H2,1,3-4H3,(H,48,50) |
| InChIKey | UVLPSKZLNOPMDG-UHFFFAOYSA-N |
| XLogP | 11.97 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.20 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|