C49H88N2O5 — CID 166667880
1-O-(3-methyloctyl) 21-O-(3-pentylocta-4,5,6,7-tetraenyl) 11-[[2-[methyl(propan-2-yl)amino]acetyl]amino]henicosanedioate (PubChem CID 166667880) has the molecular formula C49H88N2O5 and a molecular weight of 785.25 g/mol. Its IUPAC name is 1-O-(3-methyloctyl) 21-O-(3-pentylocta-4,5,6,7-tetraenyl) 11-[[2-[methyl(propan-2-yl)amino]acetyl]amino]henicosanedioate.
| Compound Name | 1-O-(3-methyloctyl) 21-O-(3-pentylocta-4,5,6,7-tetraenyl) 11-[[2-[methyl(propan-2-yl)amino]acetyl]amino]henicosanedioate |
|---|---|
| PubChem CID | 166667880 |
| Molecular Formula | C49H88N2O5 |
| Molecular Weight | 785.25 g/mol |
| Exact Mass | 784.67 |
| IUPAC Name | 1-O-(3-methyloctyl) 21-O-(3-pentylocta-4,5,6,7-tetraenyl) 11-[[2-[methyl(propan-2-yl)amino]acetyl]amino]henicosanedioate |
| SMILES | C=C=C=C=CC(CCCCC)CCOC(=O)CCCCCCCCCC(CCCCCCCCCC(=O)OCCC(C)CCCCC)NC(=O)CN(C)C(C)C |
| InChI | InChI=1S/C49H88N2O5/c1-8-11-24-31-44(6)38-40-55-48(53)36-29-22-18-14-16-20-27-34-46(50-47(52)42-51(7)43(4)5)35-28-21-17-15-19-23-30-37-49(54)56-41-39-45(32-25-12-9-2)33-26-13-10-3/h32,43-46H,2,8,10-11,13-24,26-31,33-42H2,1,3-7H3,(H,50,52) |
| InChIKey | LAXDNYAJKINYDA-UHFFFAOYSA-N |
| XLogP | 12.76 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.25 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|