C7H12F6N2O4S2 — CID 166667972
N-(2-aminopentan-2-yl)-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 166667972) has the molecular formula C7H12F6N2O4S2 and a molecular weight of 366.31 g/mol. Its IUPAC name is N-(2-aminopentan-2-yl)-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | N-(2-aminopentan-2-yl)-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 166667972 |
| Molecular Formula | C7H12F6N2O4S2 |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | N-(2-aminopentan-2-yl)-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | CCCC(C)(N)N(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H12F6N2O4S2/c1-3-4-5(2,14)15(20(16,17)6(8,9)10)21(18,19)7(11,12)13/h3-4,14H2,1-2H3 |
| InChIKey | YDLSPEDFRCQMFM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|