About 5-[(2Z,4E)-hepta-2,4-dien-4-yl]pyridine-3-thiol
5-[(2Z,4E)-hepta-2,4-dien-4-yl]pyridine-3-thiol (PubChem CID 166668173) has the molecular formula C12H15NS
and a molecular weight of 205.33 g/mol. Its IUPAC name is 5-[(2Z,4E)-hepta-2,4-dien-4-yl]pyridine-3-thiol.
Molecular Properties
| Compound Name | 5-[(2Z,4E)-hepta-2,4-dien-4-yl]pyridine-3-thiol |
| PubChem CID | 166668173 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 5-[(2Z,4E)-hepta-2,4-dien-4-yl]pyridine-3-thiol |
| SMILES | C/C=C\C(=C/CC)c1cncc(S)c1 |
| InChI | InChI=1S/C12H15NS/c1-3-5-10(6-4-2)11-7-12(14)9-13-8-11/h3,5-9,14H,4H2,1-2H3/b5-3-,10-6+ |
| InChIKey | YZSRZERJRNJAIR-UTMABKKZSA-N |
| XLogP | 3.74 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2Z,4E)-hepta-2,4-dien-4-yl]pyridine-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2Z,4E)-hepta-2,4-dien-4-yl]pyridine-3-thiol?
The IUPAC name of 5-[(2Z,4E)-hepta-2,4-dien-4-yl]pyridine-3-thiol (CID 166668173) is 5-[(2Z,4E)-hepta-2,4-dien-4-yl]pyridine-3-thiol.
What is the SMILES notation for 5-[(2Z,4E)-hepta-2,4-dien-4-yl]pyridine-3-thiol?
The canonical SMILES for 5-[(2Z,4E)-hepta-2,4-dien-4-yl]pyridine-3-thiol is C/C=C\C(=C/CC)c1cncc(S)c1.
What is the InChIKey of 5-[(2Z,4E)-hepta-2,4-dien-4-yl]pyridine-3-thiol?
The InChIKey is YZSRZERJRNJAIR-UTMABKKZSA-N. The full InChI is InChI=1S/C12H15NS/c1-3-5-10(6-4-2)11-7-12(14)9-13-8-11/h3,5-9,14H,4H2,1-2H3/b5-3-,10-6+.
What are the key properties of 5-[(2Z,4E)-hepta-2,4-dien-4-yl]pyridine-3-thiol?
5-[(2Z,4E)-hepta-2,4-dien-4-yl]pyridine-3-thiol has a molecular weight of 205.33 g/mol, XLogP of 3.74, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2Z,4E)-hepta-2,4-dien-4-yl]pyridine-3-thiol is sourced from PubChem (CID 166668173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).