C51H34N4O — CID 166668356
9-[7-[4,6-bis(3-phenylphenyl)-1,3,5-triazin-2-yl]dibenzofuran-1-yl]-4,4a-dihydrocarbazole (PubChem CID 166668356) has the molecular formula C51H34N4O and a molecular weight of 718.86 g/mol. Its IUPAC name is 9-[7-[4,6-bis(3-phenylphenyl)-1,3,5-triazin-2-yl]dibenzofuran-1-yl]-4,4a-dihydrocarbazole.
| Compound Name | 9-[7-[4,6-bis(3-phenylphenyl)-1,3,5-triazin-2-yl]dibenzofuran-1-yl]-4,4a-dihydrocarbazole |
|---|---|
| PubChem CID | 166668356 |
| Molecular Formula | C51H34N4O |
| Molecular Weight | 718.86 g/mol |
| Exact Mass | 718.27 |
| IUPAC Name | 9-[7-[4,6-bis(3-phenylphenyl)-1,3,5-triazin-2-yl]dibenzofuran-1-yl]-4,4a-dihydrocarbazole |
| SMILES | C1=CCC2C(=C1)N(c1cccc3oc4cc(-c5nc(-c6cccc(-c7ccccc7)c6)nc(-c6cccc(-c7ccccc7)c6)n5)ccc4c13)c1ccccc12 |
| InChI | InChI=1S/C51H34N4O/c1-3-14-33(15-4-1)35-18-11-20-37(30-35)49-52-50(38-21-12-19-36(31-38)34-16-5-2-6-17-34)54-51(53-49)39-28-29-42-47(32-39)56-46-27-13-26-45(48(42)46)55-43-24-9-7-22-40(43)41-23-8-10-25-44(41)55/h1-22,24-32,41H,23H2 |
| InChIKey | ZYGZYALNDDJFMT-UHFFFAOYSA-N |
| XLogP | 13.19 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.86 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |