C17H19N3O3 — CID 166668546
N-hydroxy-2-(2-propan-2-ylanilino)-2,3-dihydro-1,3-benzoxazole-5-carboxamide (PubChem CID 166668546) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is N-hydroxy-2-(2-propan-2-ylanilino)-2,3-dihydro-1,3-benzoxazole-5-carboxamide.
| Compound Name | N-hydroxy-2-(2-propan-2-ylanilino)-2,3-dihydro-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 166668546 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-hydroxy-2-(2-propan-2-ylanilino)-2,3-dihydro-1,3-benzoxazole-5-carboxamide |
| SMILES | CC(C)c1ccccc1NC1Nc2cc(C(=O)NO)ccc2O1 |
| InChI | InChI=1S/C17H19N3O3/c1-10(2)12-5-3-4-6-13(12)18-17-19-14-9-11(16(21)20-22)7-8-15(14)23-17/h3-10,17-19,22H,1-2H3,(H,20,21) |
| InChIKey | BBZBZPTZOZHHJN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|