About 7-(1H-pyrrol-2-yl)-2,3-dihydroisoindol-1-one
7-(1H-pyrrol-2-yl)-2,3-dihydroisoindol-1-one (PubChem CID 16666857) has the molecular formula C12H10N2O
and a molecular weight of 198.23 g/mol. Its IUPAC name is 7-(1H-pyrrol-2-yl)-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 7-(1H-pyrrol-2-yl)-2,3-dihydroisoindol-1-one |
| PubChem CID | 16666857 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 7-(1H-pyrrol-2-yl)-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NCc2cccc(-c3ccc[nH]3)c21 |
| InChI | InChI=1S/C12H10N2O/c15-12-11-8(7-14-12)3-1-4-9(11)10-5-2-6-13-10/h1-6,13H,7H2,(H,14,15) |
| InChIKey | WKRPBUDNPJYGTO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-(1H-pyrrol-2-yl)-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(1H-pyrrol-2-yl)-2,3-dihydroisoindol-1-one?
The IUPAC name of 7-(1H-pyrrol-2-yl)-2,3-dihydroisoindol-1-one (CID 16666857) is 7-(1H-pyrrol-2-yl)-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 7-(1H-pyrrol-2-yl)-2,3-dihydroisoindol-1-one?
The canonical SMILES for 7-(1H-pyrrol-2-yl)-2,3-dihydroisoindol-1-one is O=C1NCc2cccc(-c3ccc[nH]3)c21.
What is the InChIKey of 7-(1H-pyrrol-2-yl)-2,3-dihydroisoindol-1-one?
The InChIKey is WKRPBUDNPJYGTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O/c15-12-11-8(7-14-12)3-1-4-9(11)10-5-2-6-13-10/h1-6,13H,7H2,(H,14,15).
What are the key properties of 7-(1H-pyrrol-2-yl)-2,3-dihydroisoindol-1-one?
7-(1H-pyrrol-2-yl)-2,3-dihydroisoindol-1-one has a molecular weight of 198.23 g/mol, XLogP of 1.93, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(1H-pyrrol-2-yl)-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 16666857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).