C39H46FNO3 — CID 166669181
2-carbazol-9-yl-6-[5-fluoro-2-(4-hydroxybutoxy)phenyl]-4-(2-methyldecan-2-yl)phenol (PubChem CID 166669181) has the molecular formula C39H46FNO3 and a molecular weight of 595.80 g/mol. Its IUPAC name is 2-carbazol-9-yl-6-[5-fluoro-2-(4-hydroxybutoxy)phenyl]-4-(2-methyldecan-2-yl)phenol.
| Compound Name | 2-carbazol-9-yl-6-[5-fluoro-2-(4-hydroxybutoxy)phenyl]-4-(2-methyldecan-2-yl)phenol |
|---|---|
| PubChem CID | 166669181 |
| Molecular Formula | C39H46FNO3 |
| Molecular Weight | 595.80 g/mol |
| Exact Mass | 595.35 |
| IUPAC Name | 2-carbazol-9-yl-6-[5-fluoro-2-(4-hydroxybutoxy)phenyl]-4-(2-methyldecan-2-yl)phenol |
| SMILES | CCCCCCCCC(C)(C)c1cc(-c2cc(F)ccc2OCCCCO)c(O)c(-n2c3ccccc3c3ccccc32)c1 |
| InChI | InChI=1S/C39H46FNO3/c1-4-5-6-7-8-13-22-39(2,3)28-25-33(32-27-29(40)20-21-37(32)44-24-15-14-23-42)38(43)36(26-28)41-34-18-11-9-16-30(34)31-17-10-12-19-35(31)41/h9-12,16-21,25-27,42-43H,4-8,13-15,22-24H2,1-3H3 |
| InChIKey | GHXDUSYMSXZGBG-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.80 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|