C14H20FN — CID 166669652
(2Z,3Z,5Z)-3-(fluoromethyl)-5,6-dimethyl-2-propylideneocta-3,5,7-trien-1-imine (PubChem CID 166669652) has the molecular formula C14H20FN and a molecular weight of 221.32 g/mol. Its IUPAC name is (2Z,3Z,5Z)-3-(fluoromethyl)-5,6-dimethyl-2-propylideneocta-3,5,7-trien-1-imine.
| Compound Name | (2Z,3Z,5Z)-3-(fluoromethyl)-5,6-dimethyl-2-propylideneocta-3,5,7-trien-1-imine |
|---|---|
| PubChem CID | 166669652 |
| Molecular Formula | C14H20FN |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | (2Z,3Z,5Z)-3-(fluoromethyl)-5,6-dimethyl-2-propylideneocta-3,5,7-trien-1-imine |
| SMILES | [H]/N=C/C(=C\CC)/C(=C/C(C)=C(/C)C=C)CF |
| InChI | InChI=1S/C14H20FN/c1-5-7-13(10-16)14(9-15)8-12(4)11(3)6-2/h6-8,10,16H,2,5,9H2,1,3-4H3/b12-11-,13-7+,14-8+,16-10+ |
| InChIKey | ZKTLRJGSQZYPMA-SOJVVJRBSA-N |
| XLogP | 4.39 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|