About (2R,4R)-3-oxa-1-azatricyclo[3.3.0.02,4]octane-7-carbonitrile
(2R,4R)-3-oxa-1-azatricyclo[3.3.0.02,4]octane-7-carbonitrile (PubChem CID 166669806) has the molecular formula C7H8N2O
and a molecular weight of 136.15 g/mol. Its IUPAC name is (2R,4R)-3-oxa-1-azatricyclo[3.3.0.02,4]octane-7-carbonitrile.
Molecular Properties
| Compound Name | (2R,4R)-3-oxa-1-azatricyclo[3.3.0.02,4]octane-7-carbonitrile |
| PubChem CID | 166669806 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | (2R,4R)-3-oxa-1-azatricyclo[3.3.0.02,4]octane-7-carbonitrile |
| SMILES | N#CC1CC2[C@H]3O[C@H]3N2C1 |
| InChI | InChI=1S/C7H8N2O/c8-2-4-1-5-6-7(10-6)9(5)3-4/h4-7H,1,3H2/t4?,5?,6-,7-/m1/s1 |
| InChIKey | GPVWPGZLGBXXAL-TVVDDFTJSA-N |
| XLogP | -0.06 |
| TPSA | 39.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2R,4R)-3-oxa-1-azatricyclo[3.3.0.02,4]octane-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4R)-3-oxa-1-azatricyclo[3.3.0.02,4]octane-7-carbonitrile?
The IUPAC name of (2R,4R)-3-oxa-1-azatricyclo[3.3.0.02,4]octane-7-carbonitrile (CID 166669806) is (2R,4R)-3-oxa-1-azatricyclo[3.3.0.02,4]octane-7-carbonitrile.
What is the SMILES notation for (2R,4R)-3-oxa-1-azatricyclo[3.3.0.02,4]octane-7-carbonitrile?
The canonical SMILES for (2R,4R)-3-oxa-1-azatricyclo[3.3.0.02,4]octane-7-carbonitrile is N#CC1CC2[C@H]3O[C@H]3N2C1.
What is the InChIKey of (2R,4R)-3-oxa-1-azatricyclo[3.3.0.02,4]octane-7-carbonitrile?
The InChIKey is GPVWPGZLGBXXAL-TVVDDFTJSA-N. The full InChI is InChI=1S/C7H8N2O/c8-2-4-1-5-6-7(10-6)9(5)3-4/h4-7H,1,3H2/t4?,5?,6-,7-/m1/s1.
What are the key properties of (2R,4R)-3-oxa-1-azatricyclo[3.3.0.02,4]octane-7-carbonitrile?
(2R,4R)-3-oxa-1-azatricyclo[3.3.0.02,4]octane-7-carbonitrile has a molecular weight of 136.15 g/mol, XLogP of -0.06, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4R)-3-oxa-1-azatricyclo[3.3.0.02,4]octane-7-carbonitrile is sourced from PubChem (CID 166669806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).