C14H28O4 — CID 166669949
2-(2-ethoxyethoxy)ethyl 2,4,4-trimethylpentanoate (PubChem CID 166669949) has the molecular formula C14H28O4 and a molecular weight of 260.37 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)ethyl 2,4,4-trimethylpentanoate.
| Compound Name | 2-(2-ethoxyethoxy)ethyl 2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 166669949 |
| Molecular Formula | C14H28O4 |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 2-(2-ethoxyethoxy)ethyl 2,4,4-trimethylpentanoate |
| SMILES | CCOCCOCCOC(=O)C(C)CC(C)(C)C |
| InChI | InChI=1S/C14H28O4/c1-6-16-7-8-17-9-10-18-13(15)12(2)11-14(3,4)5/h12H,6-11H2,1-5H3 |
| InChIKey | SNYLJSMCFKQCIA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|